C30H41FO3 — CID 139869771
(3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139869771) has the molecular formula C30H41FO3 and a molecular weight of 468.65 g/mol. Its IUPAC name is (3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139869771 |
| Molecular Formula | C30H41FO3 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | (3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | C=CCCC1CCC2CC(C3CCC(C(=O)Oc4ccc(OCC=C)c(F)c4)CC3)CCC2C1 |
| InChI | InChI=1S/C30H41FO3/c1-3-5-6-21-7-8-26-19-25(14-13-24(26)18-21)22-9-11-23(12-10-22)30(32)34-27-15-16-29(28(31)20-27)33-17-4-2/h3-4,15-16,20-26H,1-2,5-14,17-19H2 |
| InChIKey | POZHFNPTLKVBDX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|