C30H33F3O3 — CID 139869893
(3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,3-difluorobenzoate (PubChem CID 139869893) has the molecular formula C30H33F3O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is (3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,3-difluorobenzoate.
| Compound Name | (3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 139869893 |
| Molecular Formula | C30H33F3O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (3-fluoro-4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,3-difluorobenzoate |
| SMILES | C=CCCC1CCC2CC(c3ccc(C(=O)Oc4ccc(OCC=C)c(F)c4)c(F)c3F)CCC2C1 |
| InChI | InChI=1S/C30H33F3O3/c1-3-5-6-19-7-8-21-17-22(10-9-20(21)16-19)24-12-13-25(29(33)28(24)32)30(34)36-23-11-14-27(26(31)18-23)35-15-4-2/h3-4,11-14,18-22H,1-2,5-10,15-17H2 |
| InChIKey | NBEPLMVOZPSLGM-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|