C28H39FO3 — CID 139866201
(2-fluoro-4-prop-2-enoxyphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139866201) has the molecular formula C28H39FO3 and a molecular weight of 442.62 g/mol. Its IUPAC name is (2-fluoro-4-prop-2-enoxyphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (2-fluoro-4-prop-2-enoxyphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139866201 |
| Molecular Formula | C28H39FO3 |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (2-fluoro-4-prop-2-enoxyphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCC(C3CCC4CC(CC)CCC4C3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H39FO3/c1-3-15-31-25-13-14-27(26(29)18-25)32-28(30)21-9-7-20(8-10-21)23-12-11-22-16-19(4-2)5-6-24(22)17-23/h3,13-14,18-24H,1,4-12,15-17H2,2H3 |
| InChIKey | HUIDITNXRPHQBL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|