C28H31F3O4 — CID 163427042
(2-fluoro-4-prop-2-enoxyphenyl) 4-[2,3-difluoro-4-(4-hydroxycyclohexyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 163427042) has the molecular formula C28H31F3O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is (2-fluoro-4-prop-2-enoxyphenyl) 4-[2,3-difluoro-4-(4-hydroxycyclohexyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | (2-fluoro-4-prop-2-enoxyphenyl) 4-[2,3-difluoro-4-(4-hydroxycyclohexyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163427042 |
| Molecular Formula | C28H31F3O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (2-fluoro-4-prop-2-enoxyphenyl) 4-[2,3-difluoro-4-(4-hydroxycyclohexyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCC(c3ccc(C4CCC(O)CC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C28H31F3O4/c1-2-15-34-21-11-14-25(24(29)16-21)35-28(33)19-5-3-17(4-6-19)22-12-13-23(27(31)26(22)30)18-7-9-20(32)10-8-18/h2,11-14,16-20,32H,1,3-10,15H2 |
| InChIKey | ANKFJUSKFZXNSY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|