C26H29F3O3 — CID 163618585
(4-cyclohexyl-2,3-difluorophenyl) 4-(2-fluoro-4-methoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 163618585) has the molecular formula C26H29F3O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is (4-cyclohexyl-2,3-difluorophenyl) 4-(2-fluoro-4-methoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | (4-cyclohexyl-2,3-difluorophenyl) 4-(2-fluoro-4-methoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163618585 |
| Molecular Formula | C26H29F3O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (4-cyclohexyl-2,3-difluorophenyl) 4-(2-fluoro-4-methoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | COc1ccc(C2CCC(C(=O)Oc3ccc(C4CCCCC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C26H29F3O3/c1-31-19-11-12-20(22(27)15-19)17-7-9-18(10-8-17)26(30)32-23-14-13-21(24(28)25(23)29)16-5-3-2-4-6-16/h11-18H,2-10H2,1H3 |
| InChIKey | HMDHEJWVKVCAFU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|