C25H35FO3 — CID 139866803
(2-fluoro-4-methoxyphenyl) 4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139866803) has the molecular formula C25H35FO3 and a molecular weight of 402.55 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl) 4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (2-fluoro-4-methoxyphenyl) 4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139866803 |
| Molecular Formula | C25H35FO3 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl) 4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | COc1ccc(OC(=O)C2CCC(C3CCC4CC(C)CCC4C3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H35FO3/c1-16-3-4-21-14-20(10-9-19(21)13-16)17-5-7-18(8-6-17)25(27)29-24-12-11-22(28-2)15-23(24)26/h11-12,15-21H,3-10,13-14H2,1-2H3 |
| InChIKey | AOLYRMRBVHECDT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|