C21H25F5O3 — CID 20654468
[3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 20654468) has the molecular formula C21H25F5O3 and a molecular weight of 420.42 g/mol. Its IUPAC name is [3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20654468 |
| Molecular Formula | C21H25F5O3 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CC1CCC(C2CCC(C(=O)Oc3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H25F5O3/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)20(27)28-16-10-17(22)19(18(23)11-16)29-21(24,25)26/h10-15H,2-9H2,1H3 |
| InChIKey | ZOLLPHIKRQTHSK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|