C23H24F4O3 — CID 162547970
[4-[3-(3,4-difluorophenoxy)-3,3-difluoropropyl]phenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 162547970) has the molecular formula C23H24F4O3 and a molecular weight of 424.43 g/mol. Its IUPAC name is [4-[3-(3,4-difluorophenoxy)-3,3-difluoropropyl]phenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-[3-(3,4-difluorophenoxy)-3,3-difluoropropyl]phenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 162547970 |
| Molecular Formula | C23H24F4O3 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [4-[3-(3,4-difluorophenoxy)-3,3-difluoropropyl]phenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Oc2ccc(CCC(F)(F)Oc3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C23H24F4O3/c1-15-2-6-17(7-3-15)22(28)29-18-8-4-16(5-9-18)12-13-23(26,27)30-19-10-11-20(24)21(25)14-19/h4-5,8-11,14-15,17H,2-3,6-7,12-13H2,1H3 |
| InChIKey | VWUSNYDGZPGIJB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|