C22H27F7O2 — CID 18650567
[4-(3,3,4,4,5,5,5-heptafluoropentyl)phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 18650567) has the molecular formula C22H27F7O2 and a molecular weight of 456.44 g/mol. Its IUPAC name is [4-(3,3,4,4,5,5,5-heptafluoropentyl)phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(3,3,4,4,5,5,5-heptafluoropentyl)phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18650567 |
| Molecular Formula | C22H27F7O2 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [4-(3,3,4,4,5,5,5-heptafluoropentyl)phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(CCC(F)(F)C(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H27F7O2/c1-2-3-4-15-5-9-17(10-6-15)19(30)31-18-11-7-16(8-12-18)13-14-20(23,24)21(25,26)22(27,28)29/h7-8,11-12,15,17H,2-6,9-10,13-14H2,1H3 |
| InChIKey | VQVWEZRHBCAQOS-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|