C28H44O2 — CID 23334679
[4-(2-methylbutyl)phenyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 23334679) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is [4-(2-methylbutyl)phenyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(2-methylbutyl)phenyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23334679 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | [4-(2-methylbutyl)phenyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C2CCC(C(=O)Oc3ccc(CC(C)CC)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H44O2/c1-4-6-7-22-8-12-24(13-9-22)25-14-16-26(17-15-25)28(29)30-27-18-10-23(11-19-27)20-21(3)5-2/h10-11,18-19,21-22,24-26H,4-9,12-17,20H2,1-3H3 |
| InChIKey | HAMHKPCTLMPGMZ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|