C30H40O4 — CID 21028985
4-O-(4-heptylphenyl) 1-O-(4-propylphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 21028985) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is 4-O-(4-heptylphenyl) 1-O-(4-propylphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(4-heptylphenyl) 1-O-(4-propylphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21028985 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 4-O-(4-heptylphenyl) 1-O-(4-propylphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCCCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(CCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H40O4/c1-3-5-6-7-8-10-24-13-21-28(22-14-24)34-30(32)26-17-15-25(16-18-26)29(31)33-27-19-11-23(9-4-2)12-20-27/h11-14,19-22,25-26H,3-10,15-18H2,1-2H3 |
| InChIKey | KELYZGCFDUOPTL-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|