C30H40O4 — CID 7154916
trans-bis(4-pentylphenyl) (1S,3S)-cyclohexane-1,3-dicarboxylate (PubChem CID 7154916) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is trans-bis(4-pentylphenyl) (1S,3S)-cyclohexane-1,3-dicarboxylate.
| Compound Name | trans-bis(4-pentylphenyl) (1S,3S)-cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7154916 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | trans-bis(4-pentylphenyl) (1S,3S)-cyclohexane-1,3-dicarboxylate |
| SMILES | CCCCCc1ccc(OC(=O)[C@H]2CCC[C@H](C(=O)Oc3ccc(CCCCC)cc3)C2)cc1 |
| InChI | InChI=1S/C30H40O4/c1-3-5-7-10-23-14-18-27(19-15-23)33-29(31)25-12-9-13-26(22-25)30(32)34-28-20-16-24(17-21-28)11-8-6-4-2/h14-21,25-26H,3-13,22H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | ATCOQQODYJAXPJ-UIOOFZCWSA-N |
| XLogP | 7.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|