C22H34O3 — CID 150842881
ethyl 3-(4-octylphenoxy)cyclopentane-1-carboxylate (PubChem CID 150842881) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is ethyl 3-(4-octylphenoxy)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-(4-octylphenoxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 150842881 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | ethyl 3-(4-octylphenoxy)cyclopentane-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(OC2CCC(C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C22H34O3/c1-3-5-6-7-8-9-10-18-11-14-20(15-12-18)25-21-16-13-19(17-21)22(23)24-4-2/h11-12,14-15,19,21H,3-10,13,16-17H2,1-2H3 |
| InChIKey | KOJIYSBZLTWQAY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|