C15H22O — CID 178142508
1-[(1R,3R)-3-methylcyclopentyl]oxy-4-propylbenzene (PubChem CID 178142508) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[(1R,3R)-3-methylcyclopentyl]oxy-4-propylbenzene.
| Compound Name | 1-[(1R,3R)-3-methylcyclopentyl]oxy-4-propylbenzene |
|---|---|
| PubChem CID | 178142508 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-[(1R,3R)-3-methylcyclopentyl]oxy-4-propylbenzene |
| SMILES | CCCc1ccc(O[C@@H]2CC[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C15H22O/c1-3-4-13-6-9-14(10-7-13)16-15-8-5-12(2)11-15/h6-7,9-10,12,15H,3-5,8,11H2,1-2H3/t12-,15-/m1/s1 |
| InChIKey | KVYFLLQFBXBAGE-IUODEOHRSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |