C26H34O2S — CID 173376127
(4-sulfanylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate (PubChem CID 173376127) has the molecular formula C26H34O2S and a molecular weight of 410.62 g/mol. Its IUPAC name is (4-sulfanylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate.
| Compound Name | (4-sulfanylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 173376127 |
| Molecular Formula | C26H34O2S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (4-sulfanylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCc1ccc(C2CCC(C(=O)Oc3ccc(S)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H34O2S/c1-2-3-4-5-6-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)26(27)28-24-16-18-25(29)19-17-24/h8-11,16-19,22-23,29H,2-7,12-15H2,1H3 |
| InChIKey | JRZNCIDNHSRWIO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|