C31H41NO2 — CID 70580600
(2-cyano-4-octylphenyl) 4-(4-propylphenyl)cyclohexane-1-carboxylate (PubChem CID 70580600) has the molecular formula C31H41NO2 and a molecular weight of 459.67 g/mol. Its IUPAC name is (2-cyano-4-octylphenyl) 4-(4-propylphenyl)cyclohexane-1-carboxylate.
| Compound Name | (2-cyano-4-octylphenyl) 4-(4-propylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70580600 |
| Molecular Formula | C31H41NO2 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | (2-cyano-4-octylphenyl) 4-(4-propylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(OC(=O)C2CCC(c3ccc(CCC)cc3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C31H41NO2/c1-3-5-6-7-8-9-11-25-14-21-30(29(22-25)23-32)34-31(33)28-19-17-27(18-20-28)26-15-12-24(10-4-2)13-16-26/h12-16,21-22,27-28H,3-11,17-20H2,1-2H3 |
| InChIKey | APBRYHLVTGZOSQ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|