C27H33NO2 — CID 70581355
(2-cyano-4-ethylphenyl) 4-[4-(2-methylbutyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 70581355) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (2-cyano-4-ethylphenyl) 4-[4-(2-methylbutyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | (2-cyano-4-ethylphenyl) 4-[4-(2-methylbutyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70581355 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (2-cyano-4-ethylphenyl) 4-[4-(2-methylbutyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | CCc1ccc(OC(=O)C2CCC(c3ccc(CC(C)CC)cc3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C27H33NO2/c1-4-19(3)16-21-6-9-22(10-7-21)23-11-13-24(14-12-23)27(29)30-26-15-8-20(5-2)17-25(26)18-28/h6-10,15,17,19,23-24H,4-5,11-14,16H2,1-3H3 |
| InChIKey | NYTIGRFUUYRKDV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|