C26H31NO2 — CID 70581533
(2-cyano-4-pentylphenyl) 4-(4-methylphenyl)cyclohexane-1-carboxylate (PubChem CID 70581533) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (2-cyano-4-pentylphenyl) 4-(4-methylphenyl)cyclohexane-1-carboxylate.
| Compound Name | (2-cyano-4-pentylphenyl) 4-(4-methylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70581533 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (2-cyano-4-pentylphenyl) 4-(4-methylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCc1ccc(OC(=O)C2CCC(c3ccc(C)cc3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C26H31NO2/c1-3-4-5-6-20-9-16-25(24(17-20)18-27)29-26(28)23-14-12-22(13-15-23)21-10-7-19(2)8-11-21/h7-11,16-17,22-23H,3-6,12-15H2,1-2H3 |
| InChIKey | RUMJKDXLVOCCKV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|