C35H49NO2 — CID 70580335
[2-cyano-4-(3-methylbutyl)phenyl] 4-(4-decylphenyl)cyclohexane-1-carboxylate (PubChem CID 70580335) has the molecular formula C35H49NO2 and a molecular weight of 515.78 g/mol. Its IUPAC name is [2-cyano-4-(3-methylbutyl)phenyl] 4-(4-decylphenyl)cyclohexane-1-carboxylate.
| Compound Name | [2-cyano-4-(3-methylbutyl)phenyl] 4-(4-decylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70580335 |
| Molecular Formula | C35H49NO2 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | [2-cyano-4-(3-methylbutyl)phenyl] 4-(4-decylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCCc1ccc(C2CCC(C(=O)Oc3ccc(CCC(C)C)cc3C#N)CC2)cc1 |
| InChI | InChI=1S/C35H49NO2/c1-4-5-6-7-8-9-10-11-12-28-15-18-30(19-16-28)31-20-22-32(23-21-31)35(37)38-34-24-17-29(14-13-27(2)3)25-33(34)26-36/h15-19,24-25,27,31-32H,4-14,20-23H2,1-3H3 |
| InChIKey | JZJCCJIUDOQMEA-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|