C33H45NO2 — CID 70582338
(4-butyl-2-cyanophenyl) 4-(4-nonylphenyl)cyclohexane-1-carboxylate (PubChem CID 70582338) has the molecular formula C33H45NO2 and a molecular weight of 487.73 g/mol. Its IUPAC name is (4-butyl-2-cyanophenyl) 4-(4-nonylphenyl)cyclohexane-1-carboxylate.
| Compound Name | (4-butyl-2-cyanophenyl) 4-(4-nonylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70582338 |
| Molecular Formula | C33H45NO2 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | (4-butyl-2-cyanophenyl) 4-(4-nonylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCc1ccc(C2CCC(C(=O)Oc3ccc(CCCC)cc3C#N)CC2)cc1 |
| InChI | InChI=1S/C33H45NO2/c1-3-5-7-8-9-10-11-13-26-14-17-28(18-15-26)29-19-21-30(22-20-29)33(35)36-32-23-16-27(12-6-4-2)24-31(32)25-34/h14-18,23-24,29-30H,3-13,19-22H2,1-2H3 |
| InChIKey | UEUMMYBJTPFMPL-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|