C17H28F6O2S — CID 173376010
fluorosulfanyl 4-(4-butylphenyl)cyclohexane-1-carboxylate;pentahydrofluoride (PubChem CID 173376010) has the molecular formula C17H28F6O2S and a molecular weight of 410.46 g/mol. Its IUPAC name is fluorosulfanyl 4-(4-butylphenyl)cyclohexane-1-carboxylate;pentahydrofluoride.
| Compound Name | fluorosulfanyl 4-(4-butylphenyl)cyclohexane-1-carboxylate;pentahydrofluoride |
|---|---|
| PubChem CID | 173376010 |
| Molecular Formula | C17H28F6O2S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | fluorosulfanyl 4-(4-butylphenyl)cyclohexane-1-carboxylate;pentahydrofluoride |
| SMILES | CCCCc1ccc(C2CCC(C(=O)OSF)CC2)cc1.F.F.F.F.F |
| InChI | InChI=1S/C17H23FO2S.5FH/c1-2-3-4-13-5-7-14(8-6-13)15-9-11-16(12-10-15)17(19)20-21-18;;;;;/h5-8,15-16H,2-4,9-12H2,1H3;5*1H |
| InChIKey | LJFSZFAHSKXBHB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|