C36H51NO2 — CID 70582337
(2-cyano-4-nonylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate (PubChem CID 70582337) has the molecular formula C36H51NO2 and a molecular weight of 529.81 g/mol. Its IUPAC name is (2-cyano-4-nonylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate.
| Compound Name | (2-cyano-4-nonylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70582337 |
| Molecular Formula | C36H51NO2 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.39 |
| IUPAC Name | (2-cyano-4-nonylphenyl) 4-(4-heptylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCc1ccc(OC(=O)C2CCC(c3ccc(CCCCCCC)cc3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C36H51NO2/c1-3-5-7-9-10-12-14-16-30-19-26-35(34(27-30)28-37)39-36(38)33-24-22-32(23-25-33)31-20-17-29(18-21-31)15-13-11-8-6-4-2/h17-21,26-27,32-33H,3-16,22-25H2,1-2H3 |
| InChIKey | VTCXGZLZSXCFKP-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|