C34H47NO2 — CID 70580393
[2-cyano-4-(2-ethylhexyl)phenyl] 4-(4-hexylphenyl)cyclohexane-1-carboxylate (PubChem CID 70580393) has the molecular formula C34H47NO2 and a molecular weight of 501.76 g/mol. Its IUPAC name is [2-cyano-4-(2-ethylhexyl)phenyl] 4-(4-hexylphenyl)cyclohexane-1-carboxylate.
| Compound Name | [2-cyano-4-(2-ethylhexyl)phenyl] 4-(4-hexylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70580393 |
| Molecular Formula | C34H47NO2 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | [2-cyano-4-(2-ethylhexyl)phenyl] 4-(4-hexylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCc1ccc(C2CCC(C(=O)Oc3ccc(CC(CC)CCCC)cc3C#N)CC2)cc1 |
| InChI | InChI=1S/C34H47NO2/c1-4-7-9-10-12-27-13-16-29(17-14-27)30-18-20-31(21-19-30)34(36)37-33-22-15-28(24-32(33)25-35)23-26(6-3)11-8-5-2/h13-17,22,24,26,30-31H,4-12,18-21,23H2,1-3H3 |
| InChIKey | HTKCKEJAUZNXRO-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|