C46H56O4 — CID 54490440
bis[4-butyl-2-(4-propylphenyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 54490440) has the molecular formula C46H56O4 and a molecular weight of 672.95 g/mol. Its IUPAC name is bis[4-butyl-2-(4-propylphenyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-butyl-2-(4-propylphenyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 54490440 |
| Molecular Formula | C46H56O4 |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.42 |
| IUPAC Name | bis[4-butyl-2-(4-propylphenyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(CCCC)cc3-c3ccc(CCC)cc3)CC2)c(-c2ccc(CCC)cc2)c1 |
| InChI | InChI=1S/C46H56O4/c1-5-9-13-35-19-29-43(41(31-35)37-21-15-33(11-7-3)16-22-37)49-45(47)39-25-27-40(28-26-39)46(48)50-44-30-20-36(14-10-6-2)32-42(44)38-23-17-34(12-8-4)18-24-38/h15-24,29-32,39-40H,5-14,25-28H2,1-4H3 |
| InChIKey | XVIOCPWZJFVNNL-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|