C34H48O6 — CID 142377352
bis[4-(6-methoxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 142377352) has the molecular formula C34H48O6 and a molecular weight of 552.75 g/mol. Its IUPAC name is bis[4-(6-methoxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-(6-methoxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 142377352 |
| Molecular Formula | C34H48O6 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | bis[4-(6-methoxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | COCCCCCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(CCCCCCOC)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H48O6/c1-37-25-9-5-3-7-11-27-13-21-31(22-14-27)39-33(35)29-17-19-30(20-18-29)34(36)40-32-23-15-28(16-24-32)12-8-4-6-10-26-38-2/h13-16,21-24,29-30H,3-12,17-20,25-26H2,1-2H3 |
| InChIKey | CEOOQFBJTFAESB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|