C24H32FNO2 — CID 54448925
(4-hexylphenyl) 4-(4-cyano-4-fluorobut-3-enyl)cyclohexane-1-carboxylate (PubChem CID 54448925) has the molecular formula C24H32FNO2 and a molecular weight of 385.52 g/mol. Its IUPAC name is (4-hexylphenyl) 4-(4-cyano-4-fluorobut-3-enyl)cyclohexane-1-carboxylate.
| Compound Name | (4-hexylphenyl) 4-(4-cyano-4-fluorobut-3-enyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54448925 |
| Molecular Formula | C24H32FNO2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (4-hexylphenyl) 4-(4-cyano-4-fluorobut-3-enyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCc1ccc(OC(=O)C2CCC(CCC=C(F)C#N)CC2)cc1 |
| InChI | InChI=1S/C24H32FNO2/c1-2-3-4-5-7-19-12-16-23(17-13-19)28-24(27)21-14-10-20(11-15-21)8-6-9-22(25)18-26/h9,12-13,16-17,20-21H,2-8,10-11,14-15H2,1H3 |
| InChIKey | WTNUNPMFEUUXDK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|