C23H28FNO2 — CID 54313281
(4-propylphenyl) 4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexane-1-carboxylate (PubChem CID 54313281) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is (4-propylphenyl) 4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexane-1-carboxylate.
| Compound Name | (4-propylphenyl) 4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54313281 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (4-propylphenyl) 4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexane-1-carboxylate |
| SMILES | CCCc1ccc(OC(=O)C2CCC(CCC=CC=C(F)C#N)CC2)cc1 |
| InChI | InChI=1S/C23H28FNO2/c1-2-6-18-11-15-22(16-12-18)27-23(26)20-13-9-19(10-14-20)7-4-3-5-8-21(24)17-25/h3,5,8,11-12,15-16,19-20H,2,4,6-7,9-10,13-14H2,1H3 |
| InChIKey | SMJQCNWTJXAUOU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|