C22H26FNO2 — CID 54542637
[4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-ethylbenzoate (PubChem CID 54542637) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is [4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-ethylbenzoate.
| Compound Name | [4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 54542637 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC2CCC(CCC=CC=C(F)C#N)CC2)cc1 |
| InChI | InChI=1S/C22H26FNO2/c1-2-17-8-12-19(13-9-17)22(25)26-21-14-10-18(11-15-21)6-4-3-5-7-20(23)16-24/h3,5,7-9,12-13,18,21H,2,4,6,10-11,14-15H2,1H3 |
| InChIKey | ZEHWLALUJIVFSV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|