C30H39F4NO — CID 54036468
2-fluoro-7-[4-[4-[4-[4-(trifluoromethoxy)phenyl]butyl]cyclohexyl]cyclohexyl]hepta-2,4-dienenitrile (PubChem CID 54036468) has the molecular formula C30H39F4NO and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-fluoro-7-[4-[4-[4-[4-(trifluoromethoxy)phenyl]butyl]cyclohexyl]cyclohexyl]hepta-2,4-dienenitrile.
| Compound Name | 2-fluoro-7-[4-[4-[4-[4-(trifluoromethoxy)phenyl]butyl]cyclohexyl]cyclohexyl]hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54036468 |
| Molecular Formula | C30H39F4NO |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-fluoro-7-[4-[4-[4-[4-(trifluoromethoxy)phenyl]butyl]cyclohexyl]cyclohexyl]hepta-2,4-dienenitrile |
| SMILES | N#CC(F)=CC=CCCC1CCC(C2CCC(CCCCc3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H39F4NO/c31-28(22-35)9-3-1-2-6-23-10-16-26(17-11-23)27-18-12-24(13-19-27)7-4-5-8-25-14-20-29(21-15-25)36-30(32,33)34/h1,3,9,14-15,20-21,23-24,26-27H,2,4-8,10-13,16-19H2 |
| InChIKey | LJHRTIVFAFLRHZ-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|