C20H21F2NO2 — CID 54505657
[4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-fluorobenzoate (PubChem CID 54505657) has the molecular formula C20H21F2NO2 and a molecular weight of 345.39 g/mol. Its IUPAC name is [4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-fluorobenzoate.
| Compound Name | [4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 54505657 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [4-(6-cyano-6-fluorohexa-3,5-dienyl)cyclohexyl] 4-fluorobenzoate |
| SMILES | N#CC(F)=CC=CCCC1CCC(OC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21F2NO2/c21-17-10-8-16(9-11-17)20(24)25-19-12-6-15(7-13-19)4-2-1-3-5-18(22)14-23/h1,3,5,8-11,15,19H,2,4,6-7,12-13H2 |
| InChIKey | YFMOLNDSTLEAFL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|