C24H31NO2 — CID 173304513
[4-(6-cyanohexa-3,5-dienyl)cyclohexyl] 4-butylbenzoate (PubChem CID 173304513) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is [4-(6-cyanohexa-3,5-dienyl)cyclohexyl] 4-butylbenzoate.
| Compound Name | [4-(6-cyanohexa-3,5-dienyl)cyclohexyl] 4-butylbenzoate |
|---|---|
| PubChem CID | 173304513 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | [4-(6-cyanohexa-3,5-dienyl)cyclohexyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC2CCC(CCC=CC=CC#N)CC2)cc1 |
| InChI | InChI=1S/C24H31NO2/c1-2-3-9-20-11-15-22(16-12-20)24(26)27-23-17-13-21(14-18-23)10-7-5-4-6-8-19-25/h4-6,8,11-12,15-16,21,23H,2-3,7,9-10,13-14,17-18H2,1H3 |
| InChIKey | AMUOOSHFDYSSOX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|