C24H37NO2 — CID 54044582
(4-butylcyclohexyl) 4-(6-cyanohexa-3,5-dienyl)cyclohexane-1-carboxylate (PubChem CID 54044582) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (4-butylcyclohexyl) 4-(6-cyanohexa-3,5-dienyl)cyclohexane-1-carboxylate.
| Compound Name | (4-butylcyclohexyl) 4-(6-cyanohexa-3,5-dienyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54044582 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (4-butylcyclohexyl) 4-(6-cyanohexa-3,5-dienyl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(OC(=O)C2CCC(CCC=CC=CC#N)CC2)CC1 |
| InChI | InChI=1S/C24H37NO2/c1-2-3-9-20-13-17-23(18-14-20)27-24(26)22-15-11-21(12-16-22)10-7-5-4-6-8-19-25/h4-6,8,20-23H,2-3,7,9-18H2,1H3 |
| InChIKey | LOQZIRKGVNXYAL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|