C22H34FNO2 — CID 54265131
[4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 54265131) has the molecular formula C22H34FNO2 and a molecular weight of 363.52 g/mol. Its IUPAC name is [4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54265131 |
| Molecular Formula | C22H34FNO2 |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | [4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)OC2CCC(CCC=C(F)C#N)CC2)CC1 |
| InChI | InChI=1S/C22H34FNO2/c1-2-3-5-17-8-12-19(13-9-17)22(25)26-21-14-10-18(11-15-21)6-4-7-20(23)16-24/h7,17-19,21H,2-6,8-15H2,1H3 |
| InChIKey | RGFJRGFBHVGTRV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|