C20H31NO2 — CID 18394200
(4-ethylcyclohexyl) 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate (PubChem CID 18394200) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (4-ethylcyclohexyl) 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate.
| Compound Name | (4-ethylcyclohexyl) 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18394200 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (4-ethylcyclohexyl) 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate |
| SMILES | CCC1CCC(OC(=O)C2CCC(CC/C=C/C#N)CC2)CC1 |
| InChI | InChI=1S/C20H31NO2/c1-2-16-9-13-19(14-10-16)23-20(22)18-11-7-17(8-12-18)6-4-3-5-15-21/h3,5,16-19H,2,4,6-14H2,1H3/b5-3+ |
| InChIKey | YOABHLKZQYFGQE-HWKANZROSA-N |
| XLogP | 5.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|