C24H29F2NO2 — CID 18394018
[4-(3,4-difluorophenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate (PubChem CID 18394018) has the molecular formula C24H29F2NO2 and a molecular weight of 401.50 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(3,4-difluorophenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18394018 |
| Molecular Formula | C24H29F2NO2 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [4-(3,4-difluorophenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate |
| SMILES | N#C/C=C/CCC1CCC(C(=O)OC2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H29F2NO2/c25-22-14-11-20(16-23(22)26)18-9-12-21(13-10-18)29-24(28)19-7-5-17(6-8-19)4-2-1-3-15-27/h1,3,11,14,16-19,21H,2,4-10,12-13H2/b3-1+ |
| InChIKey | FWNJMMDCAZBGDA-HNQUOIGGSA-N |
| XLogP | 6.20 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|