C22H27F2NO — CID 54137400
3-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile (PubChem CID 54137400) has the molecular formula C22H27F2NO and a molecular weight of 359.46 g/mol. Its IUPAC name is 3-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile.
| Compound Name | 3-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 54137400 |
| Molecular Formula | C22H27F2NO |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile |
| SMILES | N#CC=CC1CCC(OCC2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H27F2NO/c23-21-12-9-19(14-22(21)24)18-7-3-17(4-8-18)15-26-20-10-5-16(6-11-20)2-1-13-25/h1-2,9,12,14,16-18,20H,3-8,10-11,15H2 |
| InChIKey | NYRMYXRITSLAFD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|