C23H28F3NO — CID 19613483
(E)-3-[4-[[4-[4-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile (PubChem CID 19613483) has the molecular formula C23H28F3NO and a molecular weight of 391.48 g/mol. Its IUPAC name is (E)-3-[4-[[4-[4-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[[4-[4-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19613483 |
| Molecular Formula | C23H28F3NO |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (E)-3-[4-[[4-[4-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]cyclohexyl]prop-2-enenitrile |
| SMILES | N#C/C=C/C1CCC(COC2CCC(c3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H28F3NO/c24-23(25,26)21-11-7-19(8-12-21)20-9-13-22(14-10-20)28-16-18-5-3-17(4-6-18)2-1-15-27/h1-2,7-8,11-12,17-18,20,22H,3-6,9-10,13-14,16H2/b2-1+ |
| InChIKey | QRRICLSPNXGWFV-OWOJBTEDSA-N |
| XLogP | 6.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|