C25H29FN2O — CID 173304480
4-[4-[[4-(4-cyano-4-fluorobuta-1,3-dienyl)cyclohexyl]methoxy]cyclohexyl]benzonitrile (PubChem CID 173304480) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 4-[4-[[4-(4-cyano-4-fluorobuta-1,3-dienyl)cyclohexyl]methoxy]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[[4-(4-cyano-4-fluorobuta-1,3-dienyl)cyclohexyl]methoxy]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 173304480 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 4-[4-[[4-(4-cyano-4-fluorobuta-1,3-dienyl)cyclohexyl]methoxy]cyclohexyl]benzonitrile |
| SMILES | N#CC(F)=CC=CC1CCC(COC2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H29FN2O/c26-24(17-28)3-1-2-19-4-6-21(7-5-19)18-29-25-14-12-23(13-15-25)22-10-8-20(16-27)9-11-22/h1-3,8-11,19,21,23,25H,4-7,12-15,18H2 |
| InChIKey | FHYFJRYZSZYAPJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|