C25H31F4NO2 — CID 54267373
2-fluoro-5-[4-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]methoxy]cyclohexyl]pent-2-enenitrile (PubChem CID 54267373) has the molecular formula C25H31F4NO2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-fluoro-5-[4-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]methoxy]cyclohexyl]pent-2-enenitrile.
| Compound Name | 2-fluoro-5-[4-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]methoxy]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 54267373 |
| Molecular Formula | C25H31F4NO2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-fluoro-5-[4-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]methoxy]cyclohexyl]pent-2-enenitrile |
| SMILES | N#CC(F)=CCCC1CCC(OCC2CCC(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H31F4NO2/c26-22(16-30)3-1-2-18-6-12-23(13-7-18)31-17-19-4-8-20(9-5-19)21-10-14-24(15-11-21)32-25(27,28)29/h3,10-11,14-15,18-20,23H,1-2,4-9,12-13,17H2 |
| InChIKey | RHRZRWMPCCARIH-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|