C19H21F4NO2 — CID 67589363
(Z)-2-fluoro-5-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]pent-2-enenitrile (PubChem CID 67589363) has the molecular formula C19H21F4NO2 and a molecular weight of 371.37 g/mol. Its IUPAC name is (Z)-2-fluoro-5-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]pent-2-enenitrile.
| Compound Name | (Z)-2-fluoro-5-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 67589363 |
| Molecular Formula | C19H21F4NO2 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (Z)-2-fluoro-5-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]pent-2-enenitrile |
| SMILES | N#C/C(F)=C/CCC1CCC(OCc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F4NO2/c20-16(12-24)3-1-2-14-4-8-17(9-5-14)25-13-15-6-10-18(11-7-15)26-19(21,22)23/h3,6-7,10-11,14,17H,1-2,4-5,8-9,13H2/b16-3- |
| InChIKey | MLKJHTITFXJYIJ-XFQLMFQHSA-N |
| XLogP | 5.82 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|