C19H19F4NO2 — CID 67590934
[4-[(Z)-4-cyano-4-fluorobut-3-enyl]cyclohexyl] 4-(trifluoromethyl)benzoate (PubChem CID 67590934) has the molecular formula C19H19F4NO2 and a molecular weight of 369.36 g/mol. Its IUPAC name is [4-[(Z)-4-cyano-4-fluorobut-3-enyl]cyclohexyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-[(Z)-4-cyano-4-fluorobut-3-enyl]cyclohexyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 67590934 |
| Molecular Formula | C19H19F4NO2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [4-[(Z)-4-cyano-4-fluorobut-3-enyl]cyclohexyl] 4-(trifluoromethyl)benzoate |
| SMILES | N#C/C(F)=C/CCC1CCC(OC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H19F4NO2/c20-16(12-24)3-1-2-13-4-10-17(11-5-13)26-18(25)14-6-8-15(9-7-14)19(21,22)23/h3,6-9,13,17H,1-2,4-5,10-11H2/b16-3- |
| InChIKey | NBWROVYCXMLMJQ-XFQLMFQHSA-N |
| XLogP | 5.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|