C19H21NO3 — CID 19612930
[4-[(E)-5-oxopent-3-enyl]cyclohexyl] 4-cyanobenzoate (PubChem CID 19612930) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [4-[(E)-5-oxopent-3-enyl]cyclohexyl] 4-cyanobenzoate.
| Compound Name | [4-[(E)-5-oxopent-3-enyl]cyclohexyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 19612930 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [4-[(E)-5-oxopent-3-enyl]cyclohexyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OC2CCC(CC/C=C/C=O)CC2)cc1 |
| InChI | InChI=1S/C19H21NO3/c20-14-16-5-9-17(10-6-16)19(22)23-18-11-7-15(8-12-18)4-2-1-3-13-21/h1,3,5-6,9-10,13,15,18H,2,4,7-8,11-12H2/b3-1+ |
| InChIKey | BYALIWYJYSZESB-HNQUOIGGSA-N |
| XLogP | 3.81 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|