C18H21NO — CID 56637470
4-[4-(5-oxopent-3-enyl)cyclohexyl]benzonitrile (PubChem CID 56637470) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-[4-(5-oxopent-3-enyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(5-oxopent-3-enyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 56637470 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[4-(5-oxopent-3-enyl)cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(CCC=CC=O)CC2)cc1 |
| InChI | InChI=1S/C18H21NO/c19-14-16-7-11-18(12-8-16)17-9-5-15(6-10-17)4-2-1-3-13-20/h1,3,7-8,11-13,15,17H,2,4-6,9-10H2 |
| InChIKey | JPGCPLFGHCESEN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|