C18H25N — CID 66584989
4-[4-(2,2-dimethylpropyl)cyclohexyl]benzonitrile (PubChem CID 66584989) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylpropyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(2,2-dimethylpropyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 66584989 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 4-[4-(2,2-dimethylpropyl)cyclohexyl]benzonitrile |
| SMILES | CC(C)(C)CC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C18H25N/c1-18(2,3)12-14-4-8-16(9-5-14)17-10-6-15(13-19)7-11-17/h6-7,10-11,14,16H,4-5,8-9,12H2,1-3H3 |
| InChIKey | OLPOYEAWXKUFSV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |