C16H19NO — CID 18651101
4-[4-(ethenoxymethyl)cyclohexyl]benzonitrile (PubChem CID 18651101) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-[4-(ethenoxymethyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(ethenoxymethyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 18651101 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-[4-(ethenoxymethyl)cyclohexyl]benzonitrile |
| SMILES | C=COCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C16H19NO/c1-2-18-12-14-5-9-16(10-6-14)15-7-3-13(11-17)4-8-15/h2-4,7-8,14,16H,1,5-6,9-10,12H2 |
| InChIKey | FSDGPRRWLGNSBS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|