C17H19NO2 — CID 67642976
(E)-4-[4-(4-cyanophenyl)cyclohexyl]but-2-enoic acid (PubChem CID 67642976) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (E)-4-[4-(4-cyanophenyl)cyclohexyl]but-2-enoic acid.
| Compound Name | (E)-4-[4-(4-cyanophenyl)cyclohexyl]but-2-enoic acid |
|---|---|
| PubChem CID | 67642976 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (E)-4-[4-(4-cyanophenyl)cyclohexyl]but-2-enoic acid |
| SMILES | N#Cc1ccc(C2CCC(C/C=C/C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C17H19NO2/c18-12-14-6-10-16(11-7-14)15-8-4-13(5-9-15)2-1-3-17(19)20/h1,3,6-7,10-11,13,15H,2,4-5,8-9H2,(H,19,20)/b3-1+ |
| InChIKey | ASQYJWABZDRNCZ-HNQUOIGGSA-N |
| XLogP | 3.86 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|