C16H18FN — CID 54020861
4-[4-(3-fluoroprop-2-enyl)cyclohexyl]benzonitrile (PubChem CID 54020861) has the molecular formula C16H18FN and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-[4-(3-fluoroprop-2-enyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(3-fluoroprop-2-enyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54020861 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-[4-(3-fluoroprop-2-enyl)cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(CC=CF)CC2)cc1 |
| InChI | InChI=1S/C16H18FN/c17-11-1-2-13-3-7-15(8-4-13)16-9-5-14(12-18)6-10-16/h1,5-6,9-11,13,15H,2-4,7-8H2 |
| InChIKey | KYVAEZAQWGONLT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |