C24H25F2NO — CID 70177123
4-[[4-(4-but-2-enylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile (PubChem CID 70177123) has the molecular formula C24H25F2NO and a molecular weight of 381.47 g/mol. Its IUPAC name is 4-[[4-(4-but-2-enylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile.
| Compound Name | 4-[[4-(4-but-2-enylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile |
|---|---|
| PubChem CID | 70177123 |
| Molecular Formula | C24H25F2NO |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-[[4-(4-but-2-enylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile |
| SMILES | CC=CCC1CCC(c2ccc(C(F)(F)Oc3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H25F2NO/c1-2-3-4-18-5-9-20(10-6-18)21-11-13-22(14-12-21)24(25,26)28-23-15-7-19(17-27)8-16-23/h2-3,7-8,11-16,18,20H,4-6,9-10H2,1H3 |
| InChIKey | NZMGVYVQCLIRHH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|