C23H26F2O2 — CID 162547849
3-[4-[4-[difluoro-(4-methylphenyl)methoxy]phenyl]cyclohexyl]propanal (PubChem CID 162547849) has the molecular formula C23H26F2O2 and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-[4-[4-[difluoro-(4-methylphenyl)methoxy]phenyl]cyclohexyl]propanal.
| Compound Name | 3-[4-[4-[difluoro-(4-methylphenyl)methoxy]phenyl]cyclohexyl]propanal |
|---|---|
| PubChem CID | 162547849 |
| Molecular Formula | C23H26F2O2 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-[4-[4-[difluoro-(4-methylphenyl)methoxy]phenyl]cyclohexyl]propanal |
| SMILES | Cc1ccc(C(F)(F)Oc2ccc(C3CCC(CCC=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H26F2O2/c1-17-4-12-21(13-5-17)23(24,25)27-22-14-10-20(11-15-22)19-8-6-18(7-9-19)3-2-16-26/h4-5,10-16,18-19H,2-3,6-9H2,1H3 |
| InChIKey | MCWYGUFBUJAULQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|