C26H34F2O2 — CID 121323745
4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2,6-dimethylphenol (PubChem CID 121323745) has the molecular formula C26H34F2O2 and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2,6-dimethylphenol.
| Compound Name | 4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 121323745 |
| Molecular Formula | C26H34F2O2 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2,6-dimethylphenol |
| SMILES | CCCCCC1CCC(c2ccc(C(F)(F)Oc3cc(C)c(O)c(C)c3)cc2)CC1 |
| InChI | InChI=1S/C26H34F2O2/c1-4-5-6-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)26(27,28)30-24-16-18(2)25(29)19(3)17-24/h12-17,20-21,29H,4-11H2,1-3H3 |
| InChIKey | JAPGMKVWYULXEK-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|